C29H44N8O5 — CID 142475047
N-[(8S,11R,16R)-8-[3-(diaminomethylideneamino)propyl]-11-methyl-7,10,15,18-tetraoxo-16-phenyl-6,9,14,17-tetrazaspiro[4.13]octadecan-11-yl]-2-methylpropanamide (PubChem CID 142475047) has the molecular formula C29H44N8O5 and a molecular weight of 584.72 g/mol. Its IUPAC name is N-[(8S,11R,16R)-8-[3-(diaminomethylideneamino)propyl]-11-methyl-7,10,15,18-tetraoxo-16-phenyl-6,9,14,17-tetrazaspiro[4.13]octadecan-11-yl]-2-methylpropanamide.
| Compound Name | N-[(8S,11R,16R)-8-[3-(diaminomethylideneamino)propyl]-11-methyl-7,10,15,18-tetraoxo-16-phenyl-6,9,14,17-tetrazaspiro[4.13]octadecan-11-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 142475047 |
| Molecular Formula | C29H44N8O5 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | N-[(8S,11R,16R)-8-[3-(diaminomethylideneamino)propyl]-11-methyl-7,10,15,18-tetraoxo-16-phenyl-6,9,14,17-tetrazaspiro[4.13]octadecan-11-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@]1(C)CCNC(=O)[C@@H](c2ccccc2)NC(=O)C2(CCCC2)NC(=O)[C@H](CCCN=C(N)N)NC1=O |
| InChI | InChI=1S/C29H44N8O5/c1-18(2)22(38)36-28(3)15-17-32-24(40)21(19-10-5-4-6-11-19)35-26(42)29(13-7-8-14-29)37-23(39)20(34-25(28)41)12-9-16-33-27(30)31/h4-6,10-11,18,20-21H,7-9,12-17H2,1-3H3,(H,32,40)(H,34,41)(H,35,42)(H,36,38)(H,37,39)(H4,30,31,33)/t20-,21+,28+/m0/s1 |
| InChIKey | KIMHEXRUVHTANH-BALWLHIASA-N |
| XLogP | -0.14 |
| TPSA | 209.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|