C29H46N8O5 — CID 135381601
N-[(3S,6R,9R,12S)-9-[1-(diaminomethylideneamino)propyl]-6-ethyl-12-methyl-2,5,8,11-tetraoxo-3-phenyl-1,4,7,10-tetrazacyclohexadec-12-yl]-2-methylpropanamide (PubChem CID 135381601) has the molecular formula C29H46N8O5 and a molecular weight of 586.74 g/mol. Its IUPAC name is N-[(3S,6R,9R,12S)-9-[1-(diaminomethylideneamino)propyl]-6-ethyl-12-methyl-2,5,8,11-tetraoxo-3-phenyl-1,4,7,10-tetrazacyclohexadec-12-yl]-2-methylpropanamide.
| Compound Name | N-[(3S,6R,9R,12S)-9-[1-(diaminomethylideneamino)propyl]-6-ethyl-12-methyl-2,5,8,11-tetraoxo-3-phenyl-1,4,7,10-tetrazacyclohexadec-12-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 135381601 |
| Molecular Formula | C29H46N8O5 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.36 |
| IUPAC Name | N-[(3S,6R,9R,12S)-9-[1-(diaminomethylideneamino)propyl]-6-ethyl-12-methyl-2,5,8,11-tetraoxo-3-phenyl-1,4,7,10-tetrazacyclohexadec-12-yl]-2-methylpropanamide |
| SMILES | CCC(N=C(N)N)[C@H]1NC(=O)[C@@](C)(NC(=O)C(C)C)CCCCNC(=O)[C@H](c2ccccc2)NC(=O)[C@@H](CC)NC1=O |
| InChI | InChI=1S/C29H46N8O5/c1-6-19(34-28(30)31)22-26(41)33-20(7-2)24(39)35-21(18-13-9-8-10-14-18)25(40)32-16-12-11-15-29(5,27(42)36-22)37-23(38)17(3)4/h8-10,13-14,17,19-22H,6-7,11-12,15-16H2,1-5H3,(H,32,40)(H,33,41)(H,35,39)(H,36,42)(H,37,38)(H4,30,31,34)/t19?,20-,21+,22-,29+/m1/s1 |
| InChIKey | GNYKJNDJMOFVEP-BZWXTBGWSA-N |
| XLogP | 0.11 |
| TPSA | 209.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|