C26H48N6O4 — CID 157409719
N-[(3S,6R,9R)-6-[3-(diaminomethylideneamino)propyl]-3-ethyl-9-methyl-2,5,8-trioxo-1,4-diazacycloheptadec-9-yl]-2-methylpropanamide (PubChem CID 157409719) has the molecular formula C26H48N6O4 and a molecular weight of 508.71 g/mol. Its IUPAC name is N-[(3S,6R,9R)-6-[3-(diaminomethylideneamino)propyl]-3-ethyl-9-methyl-2,5,8-trioxo-1,4-diazacycloheptadec-9-yl]-2-methylpropanamide.
| Compound Name | N-[(3S,6R,9R)-6-[3-(diaminomethylideneamino)propyl]-3-ethyl-9-methyl-2,5,8-trioxo-1,4-diazacycloheptadec-9-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 157409719 |
| Molecular Formula | C26H48N6O4 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.37 |
| IUPAC Name | N-[(3S,6R,9R)-6-[3-(diaminomethylideneamino)propyl]-3-ethyl-9-methyl-2,5,8-trioxo-1,4-diazacycloheptadec-9-yl]-2-methylpropanamide |
| SMILES | CC[C@@H]1NC(=O)[C@H](CCCN=C(N)N)CC(=O)[C@](C)(NC(=O)C(C)C)CCCCCCCCNC1=O |
| InChI | InChI=1S/C26H48N6O4/c1-5-20-24(36)29-15-11-9-7-6-8-10-14-26(4,32-22(34)18(2)3)21(33)17-19(23(35)31-20)13-12-16-30-25(27)28/h18-20H,5-17H2,1-4H3,(H,29,36)(H,31,35)(H,32,34)(H4,27,28,30)/t19-,20+,26-/m1/s1 |
| InChIKey | MFFUJKQTXVRQIL-BVFVYWQFSA-N |
| XLogP | 1.90 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|