C30H47FN8O5 — CID 78122287
N-[9-[3-(diaminomethylideneamino)propyl]-6-ethyl-3-(4-fluorophenyl)-1,12-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazacyclohexadec-12-yl]-2-methylpropanamide (PubChem CID 78122287) has the molecular formula C30H47FN8O5 and a molecular weight of 618.76 g/mol. Its IUPAC name is N-[9-[3-(diaminomethylideneamino)propyl]-6-ethyl-3-(4-fluorophenyl)-1,12-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazacyclohexadec-12-yl]-2-methylpropanamide.
| Compound Name | N-[9-[3-(diaminomethylideneamino)propyl]-6-ethyl-3-(4-fluorophenyl)-1,12-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazacyclohexadec-12-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 78122287 |
| Molecular Formula | C30H47FN8O5 |
| Molecular Weight | 618.76 g/mol |
| Exact Mass | 618.37 |
| IUPAC Name | N-[9-[3-(diaminomethylideneamino)propyl]-6-ethyl-3-(4-fluorophenyl)-1,12-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazacyclohexadec-12-yl]-2-methylpropanamide |
| SMILES | CCC1NC(=O)C(CCCN=C(N)N)NC(=O)C(C)(NC(=O)C(C)C)CCCCN(C)C(=O)C(c2ccc(F)cc2)NC1=O |
| InChI | InChI=1S/C30H47FN8O5/c1-6-21-25(41)37-23(19-11-13-20(31)14-12-19)27(43)39(5)17-8-7-15-30(4,38-24(40)18(2)3)28(44)36-22(26(42)35-21)10-9-16-34-29(32)33/h11-14,18,21-23H,6-10,15-17H2,1-5H3,(H,35,42)(H,36,44)(H,37,41)(H,38,40)(H4,32,33,34) |
| InChIKey | JGIIYJOEBDGPQO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 201.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.76 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|