C29H44N8O5 — CID 135382404
N-[(3R,6S,9S,12R)-9-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]-6-ethyl-12-methyl-2,5,8,11-tetraoxo-3-phenyl-1,4,7,10-tetrazacyclotetradec-12-yl]-2-methylpropanamide (PubChem CID 135382404) has the molecular formula C29H44N8O5 and a molecular weight of 584.72 g/mol. Its IUPAC name is N-[(3R,6S,9S,12R)-9-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]-6-ethyl-12-methyl-2,5,8,11-tetraoxo-3-phenyl-1,4,7,10-tetrazacyclotetradec-12-yl]-2-methylpropanamide.
| Compound Name | N-[(3R,6S,9S,12R)-9-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]-6-ethyl-12-methyl-2,5,8,11-tetraoxo-3-phenyl-1,4,7,10-tetrazacyclotetradec-12-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 135382404 |
| Molecular Formula | C29H44N8O5 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | N-[(3R,6S,9S,12R)-9-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]-6-ethyl-12-methyl-2,5,8,11-tetraoxo-3-phenyl-1,4,7,10-tetrazacyclotetradec-12-yl]-2-methylpropanamide |
| SMILES | CC[C@@H]1NC(=O)[C@H](CCCNC2=NCCN2)NC(=O)[C@](C)(NC(=O)C(C)C)CCNC(=O)[C@@H](c2ccccc2)NC1=O |
| InChI | InChI=1S/C29H44N8O5/c1-5-20-24(39)36-22(19-10-7-6-8-11-19)26(41)30-15-13-29(4,37-23(38)18(2)3)27(42)35-21(25(40)34-20)12-9-14-31-28-32-16-17-33-28/h6-8,10-11,18,20-22H,5,9,12-17H2,1-4H3,(H,30,41)(H,34,40)(H,35,42)(H,36,39)(H,37,38)(H2,31,32,33)/t20-,21-,22+,29+/m0/s1 |
| InChIKey | AQLNAOWTHBIFJG-ZMROOPMESA-N |
| XLogP | -0.40 |
| TPSA | 181.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|