C29H45N7O6 — CID 161142045
N-[(2S,5R,10R,13R)-13-[3-(diaminomethylideneamino)propyl]-2-ethyl-5-(4-methoxyphenyl)-10-methyl-3,6,11,14-tetraoxo-1,4,7-triazacyclotetradec-10-yl]-2-methylpropanamide (PubChem CID 161142045) has the molecular formula C29H45N7O6 and a molecular weight of 587.72 g/mol. Its IUPAC name is N-[(2S,5R,10R,13R)-13-[3-(diaminomethylideneamino)propyl]-2-ethyl-5-(4-methoxyphenyl)-10-methyl-3,6,11,14-tetraoxo-1,4,7-triazacyclotetradec-10-yl]-2-methylpropanamide.
| Compound Name | N-[(2S,5R,10R,13R)-13-[3-(diaminomethylideneamino)propyl]-2-ethyl-5-(4-methoxyphenyl)-10-methyl-3,6,11,14-tetraoxo-1,4,7-triazacyclotetradec-10-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 161142045 |
| Molecular Formula | C29H45N7O6 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.34 |
| IUPAC Name | N-[(2S,5R,10R,13R)-13-[3-(diaminomethylideneamino)propyl]-2-ethyl-5-(4-methoxyphenyl)-10-methyl-3,6,11,14-tetraoxo-1,4,7-triazacyclotetradec-10-yl]-2-methylpropanamide |
| SMILES | CC[C@@H]1NC(=O)[C@H](CCCN=C(N)N)CC(=O)[C@](C)(NC(=O)C(C)C)CCNC(=O)[C@@H](c2ccc(OC)cc2)NC1=O |
| InChI | InChI=1S/C29H45N7O6/c1-6-21-26(40)35-23(18-9-11-20(42-5)12-10-18)27(41)32-15-13-29(4,36-24(38)17(2)3)22(37)16-19(25(39)34-21)8-7-14-33-28(30)31/h9-12,17,19,21,23H,6-8,13-16H2,1-5H3,(H,32,41)(H,34,39)(H,35,40)(H,36,38)(H4,30,31,33)/t19-,21+,23-,29-/m1/s1 |
| InChIKey | UNONIWPMNMWWJP-FWBDZRFQSA-N |
| XLogP | 0.43 |
| TPSA | 207.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|