C28H38O5S2 — CID 158197769
2-(4-butoxynaphthalen-1-yl)thiolane;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid (PubChem CID 158197769) has the molecular formula C28H38O5S2 and a molecular weight of 518.74 g/mol. Its IUPAC name is 2-(4-butoxynaphthalen-1-yl)thiolane;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid.
| Compound Name | 2-(4-butoxynaphthalen-1-yl)thiolane;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
|---|---|
| PubChem CID | 158197769 |
| Molecular Formula | C28H38O5S2 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-(4-butoxynaphthalen-1-yl)thiolane;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.CCCCOc1ccc(C2CCCS2)c2ccccc12 |
| InChI | InChI=1S/C18H22OS.C10H16O4S/c1-2-3-12-19-17-11-10-16(18-9-6-13-20-18)14-7-4-5-8-15(14)17;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h4-5,7-8,10-11,18H,2-3,6,9,12-13H2,1H3;7H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | GANWJHZPBJPBRX-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|