C32H42F4O7S2 — CID 160821893
[6-[2-(4-butoxynaphthalen-1-yl)thiolan-2-yl]-2-bicyclo[2.2.1]heptanyl] tert-butyl carbonate;1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 160821893) has the molecular formula C32H42F4O7S2 and a molecular weight of 678.81 g/mol. Its IUPAC name is [6-[2-(4-butoxynaphthalen-1-yl)thiolan-2-yl]-2-bicyclo[2.2.1]heptanyl] tert-butyl carbonate;1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | [6-[2-(4-butoxynaphthalen-1-yl)thiolan-2-yl]-2-bicyclo[2.2.1]heptanyl] tert-butyl carbonate;1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 160821893 |
| Molecular Formula | C32H42F4O7S2 |
| Molecular Weight | 678.81 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | [6-[2-(4-butoxynaphthalen-1-yl)thiolan-2-yl]-2-bicyclo[2.2.1]heptanyl] tert-butyl carbonate;1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | CCCCOc1ccc(C2(C3CC4CC(OC(=O)OC(C)(C)C)C3C4)CCCS2)c2ccccc12.O=S(=O)(O)C(F)(F)C(F)F |
| InChI | InChI=1S/C30H40O4S.C2H2F4O3S/c1-5-6-15-32-26-13-12-24(21-10-7-8-11-22(21)26)30(14-9-16-35-30)25-18-20-17-23(25)27(19-20)33-28(31)34-29(2,3)4;3-1(4)2(5,6)10(7,8)9/h7-8,10-13,20,23,25,27H,5-6,9,14-19H2,1-4H3;1H,(H,7,8,9) |
| InChIKey | SFQREZNRXAIWEY-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.81 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|