C32H40O12 — CID 158225872
[1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-1-oxopropan-2-yl] 3-oxobutanoate;2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl 3-oxobutanoate (PubChem CID 158225872) has the molecular formula C32H40O12 and a molecular weight of 616.66 g/mol. Its IUPAC name is [1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-1-oxopropan-2-yl] 3-oxobutanoate;2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl 3-oxobutanoate.
| Compound Name | [1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-1-oxopropan-2-yl] 3-oxobutanoate;2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl 3-oxobutanoate |
|---|---|
| PubChem CID | 158225872 |
| Molecular Formula | C32H40O12 |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | [1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-1-oxopropan-2-yl] 3-oxobutanoate;2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OC(C)(C)C(=O)c1ccc(OCCO)cc1.CC(=O)CC(=O)OCCOc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/2C16H20O6/c1-11(17)10-14(18)22-9-8-21-13-6-4-12(5-7-13)15(19)16(2,3)20;1-11(18)10-14(19)22-16(2,3)15(20)12-4-6-13(7-5-12)21-9-8-17/h4-7,20H,8-10H2,1-3H3;4-7,17H,8-10H2,1-3H3 |
| InChIKey | GDUGPUYHXGGBIF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|