C28H37NO7 — CID 158302540
benzyl N-[3-[[(4S,7R,7aS)-2,2,7-trimethyl-6-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]propyl]carbamate (PubChem CID 158302540) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is benzyl N-[3-[[(4S,7R,7aS)-2,2,7-trimethyl-6-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]propyl]carbamate.
| Compound Name | benzyl N-[3-[[(4S,7R,7aS)-2,2,7-trimethyl-6-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]propyl]carbamate |
|---|---|
| PubChem CID | 158302540 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | benzyl N-[3-[[(4S,7R,7aS)-2,2,7-trimethyl-6-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]propyl]carbamate |
| SMILES | C[C@@H]1C(COCc2ccccc2)O[C@H](OCCCNC(=O)OCc2ccccc2)C2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C28H37NO7/c1-20-23(19-31-17-21-11-6-4-7-12-21)34-26(25-24(20)35-28(2,3)36-25)32-16-10-15-29-27(30)33-18-22-13-8-5-9-14-22/h4-9,11-14,20,23-26H,10,15-19H2,1-3H3,(H,29,30)/t20-,23?,24+,25?,26+/m1/s1 |
| InChIKey | GMRAHTUPQGSPHW-MMHGUGAASA-N |
| XLogP | 4.42 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|