C26H28F6N2O6 — CID 158340514
methyl (3R)-3-acetamido-4-(2,4,5-trifluorophenyl)butanoate;methyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate;molecular hydrogen (PubChem CID 158340514) has the molecular formula C26H28F6N2O6 and a molecular weight of 578.51 g/mol. Its IUPAC name is methyl (3R)-3-acetamido-4-(2,4,5-trifluorophenyl)butanoate;methyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate;molecular hydrogen.
| Compound Name | methyl (3R)-3-acetamido-4-(2,4,5-trifluorophenyl)butanoate;methyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate;molecular hydrogen |
|---|---|
| PubChem CID | 158340514 |
| Molecular Formula | C26H28F6N2O6 |
| Molecular Weight | 578.51 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | methyl (3R)-3-acetamido-4-(2,4,5-trifluorophenyl)butanoate;methyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate;molecular hydrogen |
| SMILES | COC(=O)/C=C(/Cc1cc(F)c(F)cc1F)NC(C)=O.COC(=O)C[C@@H](Cc1cc(F)c(F)cc1F)NC(C)=O.[H][H] |
| InChI | InChI=1S/C13H14F3NO3.C13H12F3NO3.H2/c2*1-7(18)17-9(5-13(19)20-2)3-8-4-11(15)12(16)6-10(8)14;/h4,6,9H,3,5H2,1-2H3,(H,17,18);4-6H,3H2,1-2H3,(H,17,18);1H/b;9-5-;/t9-;;/m1../s1 |
| InChIKey | GRCJPHMNMNPSMC-GJHFQQCKSA-N |
| XLogP | 3.80 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|