C34H40N6O5S3 — CID 158453684
2-(methylsulfonylmethyl)-4-oxo-N-[5-oxo-5-[2-(pyridin-2-yldisulfanyl)ethylamino]pentyl]-4-[1-(1,10-phenanthrolin-4-yl)pyrrolidin-2-yl]butanamide (PubChem CID 158453684) has the molecular formula C34H40N6O5S3 and a molecular weight of 708.93 g/mol. Its IUPAC name is 2-(methylsulfonylmethyl)-4-oxo-N-[5-oxo-5-[2-(pyridin-2-yldisulfanyl)ethylamino]pentyl]-4-[1-(1,10-phenanthrolin-4-yl)pyrrolidin-2-yl]butanamide.
| Compound Name | 2-(methylsulfonylmethyl)-4-oxo-N-[5-oxo-5-[2-(pyridin-2-yldisulfanyl)ethylamino]pentyl]-4-[1-(1,10-phenanthrolin-4-yl)pyrrolidin-2-yl]butanamide |
|---|---|
| PubChem CID | 158453684 |
| Molecular Formula | C34H40N6O5S3 |
| Molecular Weight | 708.93 g/mol |
| Exact Mass | 708.22 |
| IUPAC Name | 2-(methylsulfonylmethyl)-4-oxo-N-[5-oxo-5-[2-(pyridin-2-yldisulfanyl)ethylamino]pentyl]-4-[1-(1,10-phenanthrolin-4-yl)pyrrolidin-2-yl]butanamide |
| SMILES | CS(=O)(=O)CC(CC(=O)C1CCCN1c1ccnc2c1ccc1cccnc12)C(=O)NCCCCC(=O)NCCSSc1ccccn1 |
| InChI | InChI=1S/C34H40N6O5S3/c1-48(44,45)23-25(34(43)39-16-4-2-10-30(42)35-19-21-46-47-31-11-3-5-15-36-31)22-29(41)28-9-7-20-40(28)27-14-18-38-33-26(27)13-12-24-8-6-17-37-32(24)33/h3,5-6,8,11-15,17-18,25,28H,2,4,7,9-10,16,19-23H2,1H3,(H,35,42)(H,39,43) |
| InChIKey | LCJWHSUCWWCVII-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 151.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.93 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|