C12H15F9O — CID 158465317
1,1,1,5,5,5-hexafluoro-4-methyl-2-propan-2-yloxy-3-(1,1,1-trifluoropropan-2-yl)pent-2-ene (PubChem CID 158465317) has the molecular formula C12H15F9O and a molecular weight of 346.23 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-methyl-2-propan-2-yloxy-3-(1,1,1-trifluoropropan-2-yl)pent-2-ene.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-methyl-2-propan-2-yloxy-3-(1,1,1-trifluoropropan-2-yl)pent-2-ene |
|---|---|
| PubChem CID | 158465317 |
| Molecular Formula | C12H15F9O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-methyl-2-propan-2-yloxy-3-(1,1,1-trifluoropropan-2-yl)pent-2-ene |
| SMILES | CC(C)OC(=C(C(C)C(F)(F)F)C(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H15F9O/c1-5(2)22-9(12(19,20)21)8(6(3)10(13,14)15)7(4)11(16,17)18/h5-7H,1-4H3 |
| InChIKey | HFRIXLHCGWQBIT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|