C41H33INO2P — CID 158474172
[(Z)-2-benzamido-3-oxo-1,4-diphenylbut-1-enyl]-triphenylphosphanium iodide (PubChem CID 158474172) has the molecular formula C41H33INO2P and a molecular weight of 729.60 g/mol. Its IUPAC name is [(Z)-2-benzamido-3-oxo-1,4-diphenylbut-1-enyl]-triphenylphosphanium iodide.
| Compound Name | [(Z)-2-benzamido-3-oxo-1,4-diphenylbut-1-enyl]-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 158474172 |
| Molecular Formula | C41H33INO2P |
| Molecular Weight | 729.60 g/mol |
| Exact Mass | 729.13 |
| IUPAC Name | [(Z)-2-benzamido-3-oxo-1,4-diphenylbut-1-enyl]-triphenylphosphanium iodide |
| SMILES | O=C(Cc1ccccc1)/C(NC(=O)c1ccccc1)=C(\c1ccccc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C41H32NO2P.HI/c43-38(31-32-19-7-1-8-20-32)39(42-41(44)34-23-11-3-12-24-34)40(33-21-9-2-10-22-33)45(35-25-13-4-14-26-35,36-27-15-5-16-28-36)37-29-17-6-18-30-37;/h1-30H,31H2;1H/b40-39-; |
| InChIKey | AUWNUOVCWWTTMK-IXAVWUBKSA-N |
| XLogP | 4.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|