C29H23N4O2S+ — CID 158495381
10-methylsulfonyl-5-N,7-diphenylbenzo[a]phenazin-7-ium-5,9-diamine (PubChem CID 158495381) has the molecular formula C29H23N4O2S+ and a molecular weight of 491.60 g/mol. Its IUPAC name is 10-methylsulfonyl-5-N,7-diphenylbenzo[a]phenazin-7-ium-5,9-diamine.
| Compound Name | 10-methylsulfonyl-5-N,7-diphenylbenzo[a]phenazin-7-ium-5,9-diamine |
|---|---|
| PubChem CID | 158495381 |
| Molecular Formula | C29H23N4O2S+ |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 10-methylsulfonyl-5-N,7-diphenylbenzo[a]phenazin-7-ium-5,9-diamine |
| SMILES | CS(=O)(=O)c1cc2nc3c4ccccc4c(Nc4ccccc4)cc3[n+](-c3ccccc3)c2cc1N |
| InChI | InChI=1S/C29H22N4O2S/c1-36(34,35)28-18-25-26(16-23(28)30)33(20-12-6-3-7-13-20)27-17-24(31-19-10-4-2-5-11-19)21-14-8-9-15-22(21)29(27)32-25/h2-18H,1H3,(H2,30,31)/p+1 |
| InChIKey | UDFLHVPERFPBGB-UHFFFAOYSA-O |
| XLogP | 5.55 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|