C25H21I3NO3V — CID 158534790
3'-(ethylideneamino)-2',6',7'-trimethylspiro[2-benzofuran-3,9'-xanthene]-1-one;triiodovanadium (PubChem CID 158534790) has the molecular formula C25H21I3NO3V and a molecular weight of 815.10 g/mol. Its IUPAC name is 3'-(ethylideneamino)-2',6',7'-trimethylspiro[2-benzofuran-3,9'-xanthene]-1-one;triiodovanadium.
| Compound Name | 3'-(ethylideneamino)-2',6',7'-trimethylspiro[2-benzofuran-3,9'-xanthene]-1-one;triiodovanadium |
|---|---|
| PubChem CID | 158534790 |
| Molecular Formula | C25H21I3NO3V |
| Molecular Weight | 815.10 g/mol |
| Exact Mass | 814.81 |
| IUPAC Name | 3'-(ethylideneamino)-2',6',7'-trimethylspiro[2-benzofuran-3,9'-xanthene]-1-one;triiodovanadium |
| SMILES | C/C=N/c1cc2c(cc1C)C1(OC(=O)c3ccccc31)c1cc(C)c(C)cc1O2.I[V](I)I |
| InChI | InChI=1S/C25H21NO3.3HI.V/c1-5-26-21-13-23-20(11-16(21)4)25(18-9-7-6-8-17(18)24(27)29-25)19-10-14(2)15(3)12-22(19)28-23;;;;/h5-13H,1-4H3;3*1H;/q;;;;+3/p-3/b26-5+;;;; |
| InChIKey | HNURKTFOXHSMRF-FTRYOIRLSA-K |
| XLogP | 8.56 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.10 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|