About hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene (PubChem CID 158557091) has the molecular formula C8H12O5P2+2
and a molecular weight of 250.13 g/mol. Its IUPAC name is hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene.
Molecular Properties
| Compound Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene |
| PubChem CID | 158557091 |
| Molecular Formula | C8H12O5P2+2 |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene |
| SMILES | Cc1cccc(C)c1.O=[P+](O)O[P+](=O)O |
| InChI | InChI=1S/C8H10.O5P2/c1-7-4-3-5-8(2)6-7;1-6(2)5-7(3)4/h3-6H,1-2H3;/p+2 |
| InChIKey | ATAITBWURWJWCO-UHFFFAOYSA-P |
| XLogP | 2.61 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene?
The IUPAC name of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene (CID 158557091) is hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene.
What is the SMILES notation for hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene?
The canonical SMILES for hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene is Cc1cccc(C)c1.O=[P+](O)O[P+](=O)O.
What is the InChIKey of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene?
The InChIKey is ATAITBWURWJWCO-UHFFFAOYSA-P. The full InChI is InChI=1S/C8H10.O5P2/c1-7-4-3-5-8(2)6-7;1-6(2)5-7(3)4/h3-6H,1-2H3;/p+2.
What are the key properties of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene?
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene has a molecular weight of 250.13 g/mol, XLogP of 2.61, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3-xylene is sourced from PubChem (CID 158557091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).