C38H64N8S4 — CID 158566504
(3-methyl-2-methylimino-1,3-thiazol-4-yl)methyl N,N'-dicyclohexylcarbamimidothioate (PubChem CID 158566504) has the molecular formula C38H64N8S4 and a molecular weight of 761.25 g/mol. Its IUPAC name is (3-methyl-2-methylimino-1,3-thiazol-4-yl)methyl N,N'-dicyclohexylcarbamimidothioate.
| Compound Name | (3-methyl-2-methylimino-1,3-thiazol-4-yl)methyl N,N'-dicyclohexylcarbamimidothioate |
|---|---|
| PubChem CID | 158566504 |
| Molecular Formula | C38H64N8S4 |
| Molecular Weight | 761.25 g/mol |
| Exact Mass | 760.41 |
| IUPAC Name | (3-methyl-2-methylimino-1,3-thiazol-4-yl)methyl N,N'-dicyclohexylcarbamimidothioate |
| SMILES | C/N=c1\scc(CS/C(=N\C2CCCCC2)NC2CCCCC2)n1C.C/N=c1\scc(CS/C(=N\C2CCCCC2)NC2CCCCC2)n1C |
| InChI | InChI=1S/2C19H32N4S2/c2*1-20-19-23(2)17(14-25-19)13-24-18(21-15-9-5-3-6-10-15)22-16-11-7-4-8-12-16/h2*14-16H,3-13H2,1-2H3,(H,21,22)/b2*20-19- |
| InChIKey | HRNUPCCNDDICCE-HKKNWLETSA-N |
| XLogP | 8.92 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.25 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|