C36H34F3NO — CID 158622343
3-methyl-3-phenylbutanal;4-phenyl-3-(2-phenylpropan-2-yl)-8-(trifluoromethyl)quinoline (PubChem CID 158622343) has the molecular formula C36H34F3NO and a molecular weight of 553.67 g/mol. Its IUPAC name is 3-methyl-3-phenylbutanal;4-phenyl-3-(2-phenylpropan-2-yl)-8-(trifluoromethyl)quinoline.
| Compound Name | 3-methyl-3-phenylbutanal;4-phenyl-3-(2-phenylpropan-2-yl)-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 158622343 |
| Molecular Formula | C36H34F3NO |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 3-methyl-3-phenylbutanal;4-phenyl-3-(2-phenylpropan-2-yl)-8-(trifluoromethyl)quinoline |
| SMILES | CC(C)(CC=O)c1ccccc1.CC(C)(c1ccccc1)c1cnc2c(C(F)(F)F)cccc2c1-c1ccccc1 |
| InChI | InChI=1S/C25H20F3N.C11H14O/c1-24(2,18-12-7-4-8-13-18)21-16-29-23-19(14-9-15-20(23)25(26,27)28)22(21)17-10-5-3-6-11-17;1-11(2,8-9-12)10-6-4-3-5-7-10/h3-16H,1-2H3;3-7,9H,8H2,1-2H3 |
| InChIKey | HYDURBVKKCINGO-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|