C12H25F4N3O3 — CID 158647823
2-[3-(carbonofluoridoylamino)propyl-dimethylazaniumyl]acetate;difluoromethane;1-fluoro-N,N-dimethylmethanamine (PubChem CID 158647823) has the molecular formula C12H25F4N3O3 and a molecular weight of 335.34 g/mol. Its IUPAC name is 2-[3-(carbonofluoridoylamino)propyl-dimethylazaniumyl]acetate;difluoromethane;1-fluoro-N,N-dimethylmethanamine.
| Compound Name | 2-[3-(carbonofluoridoylamino)propyl-dimethylazaniumyl]acetate;difluoromethane;1-fluoro-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 158647823 |
| Molecular Formula | C12H25F4N3O3 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-[3-(carbonofluoridoylamino)propyl-dimethylazaniumyl]acetate;difluoromethane;1-fluoro-N,N-dimethylmethanamine |
| SMILES | CN(C)CF.C[N+](C)(CCCNC(=O)F)CC(=O)[O-].FCF |
| InChI | InChI=1S/C8H15FN2O3.C3H8FN.CH2F2/c1-11(2,6-7(12)13)5-3-4-10-8(9)14;1-5(2)3-4;2-1-3/h3-6H2,1-2H3,(H-,10,12,13,14);3H2,1-2H3;1H2 |
| InChIKey | IBEKYZYAQJHKHM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|