C36H45NO10 — CID 158649472
prop-2-enyl (8S)-8-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)-8-hydroxy-5-oxooctanoate (PubChem CID 158649472) has the molecular formula C36H45NO10 and a molecular weight of 651.75 g/mol. Its IUPAC name is prop-2-enyl (8S)-8-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)-8-hydroxy-5-oxooctanoate.
| Compound Name | prop-2-enyl (8S)-8-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)-8-hydroxy-5-oxooctanoate |
|---|---|
| PubChem CID | 158649472 |
| Molecular Formula | C36H45NO10 |
| Molecular Weight | 651.75 g/mol |
| Exact Mass | 651.30 |
| IUPAC Name | prop-2-enyl (8S)-8-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)-8-hydroxy-5-oxooctanoate |
| SMILES | C=CCOC(=O)CC(CC(=O)CC[C@H](O)[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C36H45NO10/c1-6-17-42-31(40)19-22(37-34(41)43-20-28-26-13-9-7-11-24(26)25-12-8-10-14-27(25)28)18-23(38)15-16-29(39)32-33(47-36(4,5)46-32)30-21-44-35(2,3)45-30/h6-14,22,28-30,32-33,39H,1,15-21H2,2-5H3,(H,37,41)/t22?,29-,30+,32+,33+/m0/s1 |
| InChIKey | IBWROYFXOUUQHV-FDWRVZQESA-N |
| XLogP | 4.78 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|