C39H50N2O11 — CID 176836980
prop-2-enyl 5-[[5-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoate (PubChem CID 176836980) has the molecular formula C39H50N2O11 and a molecular weight of 722.83 g/mol. Its IUPAC name is prop-2-enyl 5-[[5-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoate.
| Compound Name | prop-2-enyl 5-[[5-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 176836980 |
| Molecular Formula | C39H50N2O11 |
| Molecular Weight | 722.83 g/mol |
| Exact Mass | 722.34 |
| IUPAC Name | prop-2-enyl 5-[[5-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoate |
| SMILES | C=CCOC(=O)C(CCC(=O)NCC1OC(C)(C)OC1C1OC(C)(C)OC1C1COC(C)(C)O1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C39H50N2O11/c1-8-19-45-35(43)28(41-36(44)46-21-27-25-15-11-9-13-23(25)24-14-10-12-16-26(24)27)17-18-31(42)40-20-29-32(50-38(4,5)48-29)34-33(51-39(6,7)52-34)30-22-47-37(2,3)49-30/h8-16,27-30,32-34H,1,17-22H2,2-7H3,(H,40,42)(H,41,44) |
| InChIKey | NBBQODYEQXEJCA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 149.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.83 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|