C18H27N3O6S2 — CID 158659408
6-(ethylideneamino)-5-oxo-2-[[2-[[4-oxo-5-(2-oxopropylimino)pentyl]disulfanyl]acetyl]amino]hexanoic acid (PubChem CID 158659408) has the molecular formula C18H27N3O6S2 and a molecular weight of 445.56 g/mol. Its IUPAC name is 6-(ethylideneamino)-5-oxo-2-[[2-[[4-oxo-5-(2-oxopropylimino)pentyl]disulfanyl]acetyl]amino]hexanoic acid.
| Compound Name | 6-(ethylideneamino)-5-oxo-2-[[2-[[4-oxo-5-(2-oxopropylimino)pentyl]disulfanyl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 158659408 |
| Molecular Formula | C18H27N3O6S2 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 6-(ethylideneamino)-5-oxo-2-[[2-[[4-oxo-5-(2-oxopropylimino)pentyl]disulfanyl]acetyl]amino]hexanoic acid |
| SMILES | C/C=N/CC(=O)CCC(NC(=O)CSSCCCC(=O)/C=N/CC(C)=O)C(=O)O |
| InChI | InChI=1S/C18H27N3O6S2/c1-3-19-10-15(24)6-7-16(18(26)27)21-17(25)12-29-28-8-4-5-14(23)11-20-9-13(2)22/h3,11,16H,4-10,12H2,1-2H3,(H,21,25)(H,26,27)/b19-3+,20-11+ |
| InChIKey | JRTLICIJWORLFE-QDAOUTQGSA-N |
| XLogP | 1.39 |
| TPSA | 142.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|