C25H36F3IO7 — CID 158665496
5-(2,2-dimethylbutanoyloxy)-2-iodobenzoic acid;(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 2,2-dimethylbutanoate (PubChem CID 158665496) has the molecular formula C25H36F3IO7 and a molecular weight of 632.45 g/mol. Its IUPAC name is 5-(2,2-dimethylbutanoyloxy)-2-iodobenzoic acid;(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 2,2-dimethylbutanoate.
| Compound Name | 5-(2,2-dimethylbutanoyloxy)-2-iodobenzoic acid;(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 158665496 |
| Molecular Formula | C25H36F3IO7 |
| Molecular Weight | 632.45 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | 5-(2,2-dimethylbutanoyloxy)-2-iodobenzoic acid;(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C)CC(C)(O)C(F)(F)F.CCC(C)(C)C(=O)Oc1ccc(I)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H15IO4.C12H21F3O3/c1-4-13(2,3)12(17)18-8-5-6-10(14)9(7-8)11(15)16;1-6-10(3,4)9(16)18-8(2)7-11(5,17)12(13,14)15/h5-7H,4H2,1-3H3,(H,15,16);8,17H,6-7H2,1-5H3 |
| InChIKey | IDHKCZMPOZDAFX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.45 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|