C36H42F11IO8 — CID 162109372
5-(2,2-dimethylbutanoyloxy)-2-iodobenzoic acid;2,2,4,4,5,5-hexafluoropentyl 2,2-dimethylbutanoate;(2,3,4,5,6-pentafluorophenyl) 2,2-dimethylbutanoate (PubChem CID 162109372) has the molecular formula C36H42F11IO8 and a molecular weight of 938.61 g/mol. Its IUPAC name is 5-(2,2-dimethylbutanoyloxy)-2-iodobenzoic acid;2,2,4,4,5,5-hexafluoropentyl 2,2-dimethylbutanoate;(2,3,4,5,6-pentafluorophenyl) 2,2-dimethylbutanoate.
| Compound Name | 5-(2,2-dimethylbutanoyloxy)-2-iodobenzoic acid;2,2,4,4,5,5-hexafluoropentyl 2,2-dimethylbutanoate;(2,3,4,5,6-pentafluorophenyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 162109372 |
| Molecular Formula | C36H42F11IO8 |
| Molecular Weight | 938.61 g/mol |
| Exact Mass | 938.17 |
| IUPAC Name | 5-(2,2-dimethylbutanoyloxy)-2-iodobenzoic acid;2,2,4,4,5,5-hexafluoropentyl 2,2-dimethylbutanoate;(2,3,4,5,6-pentafluorophenyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(F)(F)CC(F)(F)C(F)F.CCC(C)(C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F.CCC(C)(C)C(=O)Oc1ccc(I)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H15IO4.C12H11F5O2.C11H16F6O2/c1-4-13(2,3)12(17)18-8-5-6-10(14)9(7-8)11(15)16;1-4-12(2,3)11(18)19-10-8(16)6(14)5(13)7(15)9(10)17;1-4-9(2,3)8(18)19-6-10(14,15)5-11(16,17)7(12)13/h5-7H,4H2,1-3H3,(H,15,16);4H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | ZFYFYTVNBGNPOZ-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.61 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|