C29H50O7Si — CID 158698182
octan-3-yl 2-methoxy-3-phenylprop-2-enoate;8,8,8-trimethoxy-1-silyloctan-1-one (PubChem CID 158698182) has the molecular formula C29H50O7Si and a molecular weight of 538.80 g/mol. Its IUPAC name is octan-3-yl 2-methoxy-3-phenylprop-2-enoate;8,8,8-trimethoxy-1-silyloctan-1-one.
| Compound Name | octan-3-yl 2-methoxy-3-phenylprop-2-enoate;8,8,8-trimethoxy-1-silyloctan-1-one |
|---|---|
| PubChem CID | 158698182 |
| Molecular Formula | C29H50O7Si |
| Molecular Weight | 538.80 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | octan-3-yl 2-methoxy-3-phenylprop-2-enoate;8,8,8-trimethoxy-1-silyloctan-1-one |
| SMILES | CCCCCC(CC)OC(=O)C(=Cc1ccccc1)OC.COC(CCCCCCC(=O)[SiH3])(OC)OC |
| InChI | InChI=1S/C18H26O3.C11H24O4Si/c1-4-6-8-13-16(5-2)21-18(19)17(20-3)14-15-11-9-7-10-12-15;1-13-11(14-2,15-3)9-7-5-4-6-8-10(12)16/h7,9-12,14,16H,4-6,8,13H2,1-3H3;4-9H2,1-3,16H3 |
| InChIKey | IHEZLPWYCYHVJS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.80 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|