C31H37FN4O5 — CID 158783872
1-[2-[[2-[4-[3-[(2-ethyl-5,5-dimethyl-1,3-dioxan-2-yl)oxy]propoxy]anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]but-3-en-2-one (PubChem CID 158783872) has the molecular formula C31H37FN4O5 and a molecular weight of 564.66 g/mol. Its IUPAC name is 1-[2-[[2-[4-[3-[(2-ethyl-5,5-dimethyl-1,3-dioxan-2-yl)oxy]propoxy]anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]but-3-en-2-one.
| Compound Name | 1-[2-[[2-[4-[3-[(2-ethyl-5,5-dimethyl-1,3-dioxan-2-yl)oxy]propoxy]anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158783872 |
| Molecular Formula | C31H37FN4O5 |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 1-[2-[[2-[4-[3-[(2-ethyl-5,5-dimethyl-1,3-dioxan-2-yl)oxy]propoxy]anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccccc1Nc1nc(Nc2ccc(OCCCOC3(CC)OCC(C)(C)CO3)cc2)ncc1F |
| InChI | InChI=1S/C31H37FN4O5/c1-5-24(37)18-22-10-7-8-11-27(22)35-28-26(32)19-33-29(36-28)34-23-12-14-25(15-13-23)38-16-9-17-39-31(6-2)40-20-30(3,4)21-41-31/h5,7-8,10-15,19H,1,6,9,16-18,20-21H2,2-4H3,(H2,33,34,35,36) |
| InChIKey | IRKUVCBRGDFAPM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|