About 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide
4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide (PubChem CID 158831173) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide.
Molecular Properties
| Compound Name | 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide |
| PubChem CID | 158831173 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide |
| SMILES | C=CC(N)=O.C=CN1CCCC1=O.C=Cc1ccncc1 |
| InChI | InChI=1S/C7H7N.C6H9NO.C3H5NO/c1-2-7-3-5-8-6-4-7;1-2-7-5-3-4-6(7)8;1-2-3(4)5/h2-6H,1H2;2H,1,3-5H2;2H,1H2,(H2,4,5) |
| InChIKey | IXBHCZSALVBCJP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide?
The IUPAC name of 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide (CID 158831173) is 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide.
What is the SMILES notation for 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide?
The canonical SMILES for 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide is C=CC(N)=O.C=CN1CCCC1=O.C=Cc1ccncc1.
What is the InChIKey of 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide?
The InChIKey is IXBHCZSALVBCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N.C6H9NO.C3H5NO/c1-2-7-3-5-8-6-4-7;1-2-7-5-3-4-6(7)8;1-2-3(4)5/h2-6H,1H2;2H,1,3-5H2;2H,1H2,(H2,4,5).
What are the key properties of 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide?
4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide has a molecular weight of 287.36 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylpyridine;1-ethenylpyrrolidin-2-one;prop-2-enamide is sourced from PubChem (CID 158831173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).