C29H33ClFN6O6PS3 — CID 158870027
3-[[4-[3-[4-(3-chloro-4-fluoroanilino)-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]-2-oxopropyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]propylphosphonic acid (PubChem CID 158870027) has the molecular formula C29H33ClFN6O6PS3 and a molecular weight of 743.24 g/mol. Its IUPAC name is 3-[[4-[3-[4-(3-chloro-4-fluoroanilino)-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]-2-oxopropyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]propylphosphonic acid.
| Compound Name | 3-[[4-[3-[4-(3-chloro-4-fluoroanilino)-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]-2-oxopropyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]propylphosphonic acid |
|---|---|
| PubChem CID | 158870027 |
| Molecular Formula | C29H33ClFN6O6PS3 |
| Molecular Weight | 743.24 g/mol |
| Exact Mass | 742.10 |
| IUPAC Name | 3-[[4-[3-[4-(3-chloro-4-fluoroanilino)-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]-2-oxopropyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]propylphosphonic acid |
| SMILES | O=C(Cc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCCN1CCOCC1)Cn1nc(SCCCP(=O)(O)O)sc1=S |
| InChI | InChI=1S/C29H33ClFN6O6PS3/c30-23-15-20(3-4-24(23)31)34-27-22-14-19(13-21(38)17-37-29(45)47-28(35-37)46-12-2-11-44(39,40)41)26(16-25(22)32-18-33-27)43-8-1-5-36-6-9-42-10-7-36/h3-4,14-16,18H,1-2,5-13,17H2,(H,32,33,34)(H2,39,40,41) |
| InChIKey | JBSNOZPFGUTCPI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.24 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|