C28H51ClN6O8 — CID 158886048
(2S)-2-amino-N-[(4R)-4-(2-chloroacetyl)-7-(diaminomethylideneamino)-2-oxoheptyl]-N'-[3-[2-[2-(5-oxohexoxy)ethoxy]ethoxy]propyl]pentanediamide (PubChem CID 158886048) has the molecular formula C28H51ClN6O8 and a molecular weight of 635.20 g/mol. Its IUPAC name is (2S)-2-amino-N-[(4R)-4-(2-chloroacetyl)-7-(diaminomethylideneamino)-2-oxoheptyl]-N'-[3-[2-[2-(5-oxohexoxy)ethoxy]ethoxy]propyl]pentanediamide.
| Compound Name | (2S)-2-amino-N-[(4R)-4-(2-chloroacetyl)-7-(diaminomethylideneamino)-2-oxoheptyl]-N'-[3-[2-[2-(5-oxohexoxy)ethoxy]ethoxy]propyl]pentanediamide |
|---|---|
| PubChem CID | 158886048 |
| Molecular Formula | C28H51ClN6O8 |
| Molecular Weight | 635.20 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | (2S)-2-amino-N-[(4R)-4-(2-chloroacetyl)-7-(diaminomethylideneamino)-2-oxoheptyl]-N'-[3-[2-[2-(5-oxohexoxy)ethoxy]ethoxy]propyl]pentanediamide |
| SMILES | CC(=O)CCCCOCCOCCOCCCNC(=O)CC[C@H](N)C(=O)NCC(=O)C[C@@H](CCCN=C(N)N)C(=O)CCl |
| InChI | InChI=1S/C28H51ClN6O8/c1-21(36)6-2-3-12-41-14-16-43-17-15-42-13-5-11-33-26(39)9-8-24(30)27(40)35-20-23(37)18-22(25(38)19-29)7-4-10-34-28(31)32/h22,24H,2-20,30H2,1H3,(H,33,39)(H,35,40)(H4,31,32,34)/t22-,24+/m1/s1 |
| InChIKey | KEDRNZJQXPNWEK-VWNXMTODSA-N |
| XLogP | -0.04 |
| TPSA | 227.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.20 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|