C31H64N2O4 — CID 158895889
1-ethyl-4-methoxy-2,2,6,6-tetramethylpiperidine;3-methoxypentane;1-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-2-one (PubChem CID 158895889) has the molecular formula C31H64N2O4 and a molecular weight of 528.86 g/mol. Its IUPAC name is 1-ethyl-4-methoxy-2,2,6,6-tetramethylpiperidine;3-methoxypentane;1-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-2-one.
| Compound Name | 1-ethyl-4-methoxy-2,2,6,6-tetramethylpiperidine;3-methoxypentane;1-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-2-one |
|---|---|
| PubChem CID | 158895889 |
| Molecular Formula | C31H64N2O4 |
| Molecular Weight | 528.86 g/mol |
| Exact Mass | 528.49 |
| IUPAC Name | 1-ethyl-4-methoxy-2,2,6,6-tetramethylpiperidine;3-methoxypentane;1-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-2-one |
| SMILES | CC(=O)COC1CC(C)(C)N(C)C(C)(C)C1.CCC(CC)OC.CCN1C(C)(C)CC(OC)CC1(C)C |
| InChI | InChI=1S/C13H25NO2.C12H25NO.C6H14O/c1-10(15)9-16-11-7-12(2,3)14(6)13(4,5)8-11;1-7-13-11(2,3)8-10(14-6)9-12(13,4)5;1-4-6(5-2)7-3/h11H,7-9H2,1-6H3;10H,7-9H2,1-6H3;6H,4-5H2,1-3H3 |
| InChIKey | JEVCBIWYDWNKPQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.86 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |