C21H31FN5O9P — CID 158992567
[(2S)-2-acetamido-2-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl] [(2S,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-fluorooxolan-2-yl]methyl hydrogen phosphate (PubChem CID 158992567) has the molecular formula C21H31FN5O9P and a molecular weight of 547.48 g/mol. Its IUPAC name is [(2S)-2-acetamido-2-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl] [(2S,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-fluorooxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2S)-2-acetamido-2-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl] [(2S,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-fluorooxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 158992567 |
| Molecular Formula | C21H31FN5O9P |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | [(2S)-2-acetamido-2-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl] [(2S,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-fluorooxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CC(=O)N[C@@H](COP(=O)(O)OC[C@@H]1CC(F)[C@H](n2ccc3c(=O)[nH]c(N)nc32)O1)[C@@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C21H31FN5O9P/c1-10-16(36-21(3,4)35-10)15(24-11(2)28)9-33-37(30,31)32-8-12-7-14(22)19(34-12)27-6-5-13-17(27)25-20(23)26-18(13)29/h5-6,10,12,14-16,19H,7-9H2,1-4H3,(H,24,28)(H,30,31)(H3,23,25,26,29)/t10-,12+,14?,15+,16-,19-/m1/s1 |
| InChIKey | JQINYNKCDHWVGJ-LFNYJYRRSA-N |
| XLogP | 1.11 |
| TPSA | 189.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|