C20H30N3O10P — CID 158994413
[2-[(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)methoxy]ethyl-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 158994413) has the molecular formula C20H30N3O10P and a molecular weight of 503.45 g/mol. Its IUPAC name is [2-[(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)methoxy]ethyl-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [2-[(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)methoxy]ethyl-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 158994413 |
| Molecular Formula | C20H30N3O10P |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | [2-[(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)methoxy]ethyl-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | Cc1ncnn2c(COCCP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C)ccc12 |
| InChI | InChI=1S/C20H30N3O10P/c1-14(2)32-19(24)28-12-30-34(26,31-13-29-20(25)33-15(3)4)9-8-27-10-17-6-7-18-16(5)21-11-22-23(17)18/h6-7,11,14-15H,8-10,12-13H2,1-5H3 |
| InChIKey | MHIAYOBAFPCDQW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 146.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|