C12H14N2O2 — CID 158996695
3-propan-2-yl-7,9-dihydro-6H-pyrido[2,3-b]azepine-5,8-dione (PubChem CID 158996695) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-propan-2-yl-7,9-dihydro-6H-pyrido[2,3-b]azepine-5,8-dione.
| Compound Name | 3-propan-2-yl-7,9-dihydro-6H-pyrido[2,3-b]azepine-5,8-dione |
|---|---|
| PubChem CID | 158996695 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-propan-2-yl-7,9-dihydro-6H-pyrido[2,3-b]azepine-5,8-dione |
| SMILES | CC(C)c1cnc2c(c1)C(=O)CCC(=O)N2 |
| InChI | InChI=1S/C12H14N2O2/c1-7(2)8-5-9-10(15)3-4-11(16)14-12(9)13-6-8/h5-7H,3-4H2,1-2H3,(H,13,14,16) |
| InChIKey | REOIXZIBEGCHIW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |