C29H28BrF3N10O5 — CID 159002498
1-[(6-bromo-3-pyridinyl)methyl]-3,7-dimethylpurine-2,6-dione;3,7-dimethyl-1-[[6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-3-pyridinyl]methyl]purine-2,6-dione (PubChem CID 159002498) has the molecular formula C29H28BrF3N10O5 and a molecular weight of 733.51 g/mol. Its IUPAC name is 1-[(6-bromo-3-pyridinyl)methyl]-3,7-dimethylpurine-2,6-dione;3,7-dimethyl-1-[[6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-3-pyridinyl]methyl]purine-2,6-dione.
| Compound Name | 1-[(6-bromo-3-pyridinyl)methyl]-3,7-dimethylpurine-2,6-dione;3,7-dimethyl-1-[[6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-3-pyridinyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 159002498 |
| Molecular Formula | C29H28BrF3N10O5 |
| Molecular Weight | 733.51 g/mol |
| Exact Mass | 732.14 |
| IUPAC Name | 1-[(6-bromo-3-pyridinyl)methyl]-3,7-dimethylpurine-2,6-dione;3,7-dimethyl-1-[[6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-3-pyridinyl]methyl]purine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(Cc1ccc(Br)nc1)c(=O)n2C.Cn1cnc2c1c(=O)n(Cc1ccc(C(C)(O)C(F)(F)F)nc1)c(=O)n2C |
| InChI | InChI=1S/C16H16F3N5O3.C13H12BrN5O2/c1-15(27,16(17,18)19)10-5-4-9(6-20-10)7-24-13(25)11-12(21-8-22(11)2)23(3)14(24)26;1-17-7-16-11-10(17)12(20)19(13(21)18(11)2)6-8-3-4-9(14)15-5-8/h4-6,8,27H,7H2,1-3H3;3-5,7H,6H2,1-2H3 |
| InChIKey | JRMVILRENMAESH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 169.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.51 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|