C16H20F3N5O3S — CID 162575446
3,7-dimethyl-1-[2-[4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,3-thiazol-5-yl]ethyl]purine-2,6-dione (PubChem CID 162575446) has the molecular formula C16H20F3N5O3S and a molecular weight of 419.43 g/mol. Its IUPAC name is 3,7-dimethyl-1-[2-[4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,3-thiazol-5-yl]ethyl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-[2-[4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,3-thiazol-5-yl]ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 162575446 |
| Molecular Formula | C16H20F3N5O3S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3,7-dimethyl-1-[2-[4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,3-thiazol-5-yl]ethyl]purine-2,6-dione |
| SMILES | CC1N=C(C(C)(O)C(F)(F)F)SC1CCn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C16H20F3N5O3S/c1-8-9(28-13(21-8)15(2,27)16(17,18)19)5-6-24-12(25)10-11(20-7-22(10)3)23(4)14(24)26/h7-9,27H,5-6H2,1-4H3 |
| InChIKey | JQPXLLRYKFKADT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |