C24H32N4O20S — CID 159021328
(2,5-dioxopyrrolidin-1-yl) 2-[2-(2,5-dioxopyrrolidin-1-yl)peroxyethoxymethoxy]acetate;1-[2-[2-(2,5-dioxopyrrolidin-1-yl)peroxyethoxymethoxy]acetyl]aziridine-2-sulfonic acid (PubChem CID 159021328) has the molecular formula C24H32N4O20S and a molecular weight of 728.59 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-(2,5-dioxopyrrolidin-1-yl)peroxyethoxymethoxy]acetate;1-[2-[2-(2,5-dioxopyrrolidin-1-yl)peroxyethoxymethoxy]acetyl]aziridine-2-sulfonic acid.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-(2,5-dioxopyrrolidin-1-yl)peroxyethoxymethoxy]acetate;1-[2-[2-(2,5-dioxopyrrolidin-1-yl)peroxyethoxymethoxy]acetyl]aziridine-2-sulfonic acid |
|---|---|
| PubChem CID | 159021328 |
| Molecular Formula | C24H32N4O20S |
| Molecular Weight | 728.59 g/mol |
| Exact Mass | 728.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-(2,5-dioxopyrrolidin-1-yl)peroxyethoxymethoxy]acetate;1-[2-[2-(2,5-dioxopyrrolidin-1-yl)peroxyethoxymethoxy]acetyl]aziridine-2-sulfonic acid |
| SMILES | O=C(COCOCCOON1C(=O)CCC1=O)ON1C(=O)CCC1=O.O=C1CCC(=O)N1OOCCOCOCC(=O)N1CC1S(=O)(=O)O |
| InChI | InChI=1S/C13H16N2O10.C11H16N2O10S/c16-9-1-2-10(17)14(9)24-13(20)7-22-8-21-5-6-23-25-15-11(18)3-4-12(15)19;14-8-1-2-9(15)13(8)23-22-4-3-20-7-21-6-10(16)12-5-11(12)24(17,18)19/h1-8H2;11H,1-7H2,(H,17,18,19) |
| InChIKey | JTSVZVHUVKOJGA-UHFFFAOYSA-N |
| XLogP | -3.36 |
| TPSA | 286.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.59 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|