C11H18N2O10S — CID 91492503
2-[[2-[2-(2,5-dioxopyrrolidin-1-yl)peroxyethoxymethoxy]acetyl]amino]ethanesulfonic acid (PubChem CID 91492503) has the molecular formula C11H18N2O10S and a molecular weight of 370.34 g/mol. Its IUPAC name is 2-[[2-[2-(2,5-dioxopyrrolidin-1-yl)peroxyethoxymethoxy]acetyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2-[2-(2,5-dioxopyrrolidin-1-yl)peroxyethoxymethoxy]acetyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 91492503 |
| Molecular Formula | C11H18N2O10S |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 2-[[2-[2-(2,5-dioxopyrrolidin-1-yl)peroxyethoxymethoxy]acetyl]amino]ethanesulfonic acid |
| SMILES | O=C(COCOCCOON1C(=O)CCC1=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C11H18N2O10S/c14-9(12-3-6-24(17,18)19)7-21-8-20-4-5-22-23-13-10(15)1-2-11(13)16/h1-8H2,(H,12,14)(H,17,18,19) |
| InChIKey | QLTCTYGDAVFWKU-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 157.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|