C18H28ClFO4 — CID 159032159
(2-chloro-3-fluoro-4-methylcyclohexyl)-[5-(5-methyl-1,3-dioxan-2-yl)oxan-2-yl]methanone (PubChem CID 159032159) has the molecular formula C18H28ClFO4 and a molecular weight of 362.87 g/mol. Its IUPAC name is (2-chloro-3-fluoro-4-methylcyclohexyl)-[5-(5-methyl-1,3-dioxan-2-yl)oxan-2-yl]methanone.
| Compound Name | (2-chloro-3-fluoro-4-methylcyclohexyl)-[5-(5-methyl-1,3-dioxan-2-yl)oxan-2-yl]methanone |
|---|---|
| PubChem CID | 159032159 |
| Molecular Formula | C18H28ClFO4 |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (2-chloro-3-fluoro-4-methylcyclohexyl)-[5-(5-methyl-1,3-dioxan-2-yl)oxan-2-yl]methanone |
| SMILES | CC1COC(C2CCC(C(=O)C3CCC(C)C(F)C3Cl)OC2)OC1 |
| InChI | InChI=1S/C18H28ClFO4/c1-10-7-23-18(24-8-10)12-4-6-14(22-9-12)17(21)13-5-3-11(2)16(20)15(13)19/h10-16,18H,3-9H2,1-2H3 |
| InChIKey | ZHDJUYJGOHLGPX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|