C10H18O4 — CID 163690105
5-(5-methyl-1,3-dioxan-2-yl)oxan-2-ol (PubChem CID 163690105) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 5-(5-methyl-1,3-dioxan-2-yl)oxan-2-ol.
| Compound Name | 5-(5-methyl-1,3-dioxan-2-yl)oxan-2-ol |
|---|---|
| PubChem CID | 163690105 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 5-(5-methyl-1,3-dioxan-2-yl)oxan-2-ol |
| SMILES | CC1COC(C2CCC(O)OC2)OC1 |
| InChI | InChI=1S/C10H18O4/c1-7-4-13-10(14-5-7)8-2-3-9(11)12-6-8/h7-11H,2-6H2,1H3 |
| InChIKey | JSGFDSJNGOAWHB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |