C24H38O4P+ — CID 159044686
2,5-dimethyl-2-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]hexanoic acid;oxophosphanium (PubChem CID 159044686) has the molecular formula C24H38O4P+ and a molecular weight of 421.54 g/mol. Its IUPAC name is 2,5-dimethyl-2-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]hexanoic acid;oxophosphanium.
| Compound Name | 2,5-dimethyl-2-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]hexanoic acid;oxophosphanium |
|---|---|
| PubChem CID | 159044686 |
| Molecular Formula | C24H38O4P+ |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 2,5-dimethyl-2-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]hexanoic acid;oxophosphanium |
| SMILES | Cc1cc(C)c(C(=O)C2(C(C)(CCC(C)C)C(=O)O)CCCCC2)c(C)c1.O=[PH2+] |
| InChI | InChI=1S/C24H36O3.H2OP/c1-16(2)10-13-23(6,22(26)27)24(11-8-7-9-12-24)21(25)20-18(4)14-17(3)15-19(20)5;1-2/h14-16H,7-13H2,1-6H3,(H,26,27);2H2/q;+1 |
| InChIKey | WFYZKZFHWPCRHA-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|