C19H28O2P+ — CID 173194836
butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium (PubChem CID 173194836) has the molecular formula C19H28O2P+ and a molecular weight of 319.41 g/mol. Its IUPAC name is butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium.
| Compound Name | butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium |
|---|---|
| PubChem CID | 173194836 |
| Molecular Formula | C19H28O2P+ |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | butan-2-yl-oxo-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]phosphanium |
| SMILES | CCC(C)[P+](=O)C1(C(=O)c2c(C)cc(C)cc2C)CCCC1 |
| InChI | InChI=1S/C19H28O2P/c1-6-16(5)22(21)19(9-7-8-10-19)18(20)17-14(3)11-13(2)12-15(17)4/h11-12,16H,6-10H2,1-5H3/q+1 |
| InChIKey | MDNHLPYRWFDMOV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|