C25H39O4P — CID 174386724
4-ethyl-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]octanoic acid;oxophosphane (PubChem CID 174386724) has the molecular formula C25H39O4P and a molecular weight of 434.56 g/mol. Its IUPAC name is 4-ethyl-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]octanoic acid;oxophosphane.
| Compound Name | 4-ethyl-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]octanoic acid;oxophosphane |
|---|---|
| PubChem CID | 174386724 |
| Molecular Formula | C25H39O4P |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 4-ethyl-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]octanoic acid;oxophosphane |
| SMILES | CCCCC(CC)CC(C(=O)O)C1(C(=O)c2c(C)cc(C)cc2C)CCCC1.O=P |
| InChI | InChI=1S/C25H38O3.HOP/c1-6-8-11-20(7-2)16-21(24(27)28)25(12-9-10-13-25)23(26)22-18(4)14-17(3)15-19(22)5;1-2/h14-15,20-21H,6-13,16H2,1-5H3,(H,27,28);2H |
| InChIKey | UXVAZWDWEPJZKR-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|