C25H38O3 — CID 159234446
2-methyl-2-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]octanoic acid (PubChem CID 159234446) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 2-methyl-2-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]octanoic acid.
| Compound Name | 2-methyl-2-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]octanoic acid |
|---|---|
| PubChem CID | 159234446 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 2-methyl-2-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]octanoic acid |
| SMILES | CCCCCCC(C)(C(=O)O)C1(C(=O)c2c(C)cc(C)cc2C)CCCCC1 |
| InChI | InChI=1S/C25H38O3/c1-6-7-8-10-13-24(5,23(27)28)25(14-11-9-12-15-25)22(26)21-19(3)16-18(2)17-20(21)4/h16-17H,6-15H2,1-5H3,(H,27,28) |
| InChIKey | LEIVVSDXEPWKCM-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|