About copper bis(but-2-enoate)
copper bis(but-2-enoate) (PubChem CID 159139250) has the molecular formula C8H10CuO4
and a molecular weight of 233.71 g/mol. Its IUPAC name is copper bis(but-2-enoate).
Molecular Properties
| Compound Name | copper bis(but-2-enoate) |
| PubChem CID | 159139250 |
| Molecular Formula | C8H10CuO4 |
| Molecular Weight | 233.71 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | copper bis(but-2-enoate) |
| SMILES | CC=CC(=O)[O-].CC=CC(=O)[O-].[Cu+2] |
| InChI | InChI=1S/2C4H6O2.Cu/c2*1-2-3-4(5)6;/h2*2-3H,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | KHWUOWNSXKBYAL-UHFFFAOYSA-L |
| XLogP | -1.38 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.71 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze copper bis(but-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(but-2-enoate)?
The IUPAC name of copper bis(but-2-enoate) (CID 159139250) is copper bis(but-2-enoate).
What is the SMILES notation for copper bis(but-2-enoate)?
The canonical SMILES for copper bis(but-2-enoate) is CC=CC(=O)[O-].CC=CC(=O)[O-].[Cu+2].
What is the InChIKey of copper bis(but-2-enoate)?
The InChIKey is KHWUOWNSXKBYAL-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H6O2.Cu/c2*1-2-3-4(5)6;/h2*2-3H,1H3,(H,5,6);/q;;+2/p-2.
What are the key properties of copper bis(but-2-enoate)?
copper bis(but-2-enoate) has a molecular weight of 233.71 g/mol, XLogP of -1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(but-2-enoate) is sourced from PubChem (CID 159139250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).