About lithium but-2-enoate
lithium but-2-enoate (PubChem CID 141266834) has the molecular formula C4H5LiO2
and a molecular weight of 92.02 g/mol. Its IUPAC name is lithium but-2-enoate.
Molecular Properties
| Compound Name | lithium but-2-enoate |
| PubChem CID | 141266834 |
| Molecular Formula | C4H5LiO2 |
| Molecular Weight | 92.02 g/mol |
| Exact Mass | 92.04 |
| IUPAC Name | lithium but-2-enoate |
| SMILES | CC=CC(=O)[O-].[Li+] |
| InChI | InChI=1S/C4H6O2.Li/c1-2-3-4(5)6;/h2-3H,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | YDRRXWLXTGEPCL-UHFFFAOYSA-M |
| XLogP | -3.68 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.02 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium but-2-enoate?
The IUPAC name of lithium but-2-enoate (CID 141266834) is lithium but-2-enoate.
What is the SMILES notation for lithium but-2-enoate?
The canonical SMILES for lithium but-2-enoate is CC=CC(=O)[O-].[Li+].
What is the InChIKey of lithium but-2-enoate?
The InChIKey is YDRRXWLXTGEPCL-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O2.Li/c1-2-3-4(5)6;/h2-3H,1H3,(H,5,6);/q;+1/p-1.
What are the key properties of lithium but-2-enoate?
lithium but-2-enoate has a molecular weight of 92.02 g/mol, XLogP of -3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium but-2-enoate is sourced from PubChem (CID 141266834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).