About but-2-enoate;mercury(1+)
but-2-enoate;mercury(1+) (PubChem CID 173230436) has the molecular formula C4H5HgO2
and a molecular weight of 285.67 g/mol. Its IUPAC name is but-2-enoate;mercury(1+).
Molecular Properties
| Compound Name | but-2-enoate;mercury(1+) |
| PubChem CID | 173230436 |
| Molecular Formula | C4H5HgO2 |
| Molecular Weight | 285.67 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | but-2-enoate;mercury(1+) |
| SMILES | CC=CC(=O)[O-].[Hg+] |
| InChI | InChI=1S/C4H6O2.Hg/c1-2-3-4(5)6;/h2-3H,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | ITZOGUWEWZOWMV-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.67 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enoate;mercury(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enoate;mercury(1+)?
The IUPAC name of but-2-enoate;mercury(1+) (CID 173230436) is but-2-enoate;mercury(1+).
What is the SMILES notation for but-2-enoate;mercury(1+)?
The canonical SMILES for but-2-enoate;mercury(1+) is CC=CC(=O)[O-].[Hg+].
What is the InChIKey of but-2-enoate;mercury(1+)?
The InChIKey is ITZOGUWEWZOWMV-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O2.Hg/c1-2-3-4(5)6;/h2-3H,1H3,(H,5,6);/q;+1/p-1.
What are the key properties of but-2-enoate;mercury(1+)?
but-2-enoate;mercury(1+) has a molecular weight of 285.67 g/mol, XLogP of -0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enoate;mercury(1+) is sourced from PubChem (CID 173230436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).