C33H51BrCl2N8O5Si — CID 159159798
3-bromopropoxy-tert-butyl-dimethylsilane;1-butyl-8-chloro-3-ethyl-7-prop-2-enylpurine-2,6-dione;8-chloro-3-ethyl-7-prop-2-enylpurine-2,6-dione (PubChem CID 159159798) has the molecular formula C33H51BrCl2N8O5Si and a molecular weight of 818.72 g/mol. Its IUPAC name is 3-bromopropoxy-tert-butyl-dimethylsilane;1-butyl-8-chloro-3-ethyl-7-prop-2-enylpurine-2,6-dione;8-chloro-3-ethyl-7-prop-2-enylpurine-2,6-dione.
| Compound Name | 3-bromopropoxy-tert-butyl-dimethylsilane;1-butyl-8-chloro-3-ethyl-7-prop-2-enylpurine-2,6-dione;8-chloro-3-ethyl-7-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 159159798 |
| Molecular Formula | C33H51BrCl2N8O5Si |
| Molecular Weight | 818.72 g/mol |
| Exact Mass | 816.23 |
| IUPAC Name | 3-bromopropoxy-tert-butyl-dimethylsilane;1-butyl-8-chloro-3-ethyl-7-prop-2-enylpurine-2,6-dione;8-chloro-3-ethyl-7-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(Cl)nc2c1c(=O)[nH]c(=O)n2CC.C=CCn1c(Cl)nc2c1c(=O)n(CCCC)c(=O)n2CC.CC(C)(C)[Si](C)(C)OCCCBr |
| InChI | InChI=1S/C14H19ClN4O2.C10H11ClN4O2.C9H21BrOSi/c1-4-7-9-19-12(20)10-11(17(6-3)14(19)21)16-13(15)18(10)8-5-2;1-3-5-15-6-7(12-9(15)11)14(4-2)10(17)13-8(6)16;1-9(2,3)12(4,5)11-8-6-7-10/h5H,2,4,6-9H2,1,3H3;3H,1,4-5H2,2H3,(H,13,16,17);6-8H2,1-5H3 |
| InChIKey | KKIQMILYYOMMQV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 143.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.72 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|