C28H27F3N2O3S — CID 159174854
1,1-diphenyl-2-(2,4,6-trimethylphenyl)hydrazine;4-(trifluoromethyl)benzenesulfonic acid (PubChem CID 159174854) has the molecular formula C28H27F3N2O3S and a molecular weight of 528.60 g/mol. Its IUPAC name is 1,1-diphenyl-2-(2,4,6-trimethylphenyl)hydrazine;4-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 1,1-diphenyl-2-(2,4,6-trimethylphenyl)hydrazine;4-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 159174854 |
| Molecular Formula | C28H27F3N2O3S |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 1,1-diphenyl-2-(2,4,6-trimethylphenyl)hydrazine;4-(trifluoromethyl)benzenesulfonic acid |
| SMILES | Cc1cc(C)c(NN(c2ccccc2)c2ccccc2)c(C)c1.O=S(=O)(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22N2.C7H5F3O3S/c1-16-14-17(2)21(18(3)15-16)22-23(19-10-6-4-7-11-19)20-12-8-5-9-13-20;8-7(9,10)5-1-3-6(4-2-5)14(11,12)13/h4-15,22H,1-3H3;1-4H,(H,11,12,13) |
| InChIKey | KMDKSHWRFQTEOQ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|