C39H49N6O5PS — CID 159248326
3-[2-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(1,3-thiazol-5-yl)-1,2,4-triazol-1-yl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile;methane (PubChem CID 159248326) has the molecular formula C39H49N6O5PS and a molecular weight of 744.90 g/mol. Its IUPAC name is 3-[2-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(1,3-thiazol-5-yl)-1,2,4-triazol-1-yl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile;methane.
| Compound Name | 3-[2-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(1,3-thiazol-5-yl)-1,2,4-triazol-1-yl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile;methane |
|---|---|
| PubChem CID | 159248326 |
| Molecular Formula | C39H49N6O5PS |
| Molecular Weight | 744.90 g/mol |
| Exact Mass | 744.32 |
| IUPAC Name | 3-[2-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(1,3-thiazol-5-yl)-1,2,4-triazol-1-yl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile;methane |
| SMILES | C.COc1ccc(C(OCc2nc(-c3cncs3)nn2CCOP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H45N6O5PS.CH4/c1-28(2)44(29(3)4)50(48-23-10-21-39)49-24-22-43-36(41-37(42-43)35-25-40-27-51-35)26-47-38(30-11-8-7-9-12-30,31-13-17-33(45-5)18-14-31)32-15-19-34(46-6)20-16-32;/h7-9,11-20,25,27-29H,10,22-24,26H2,1-6H3;1H4 |
| InChIKey | KUYPVUMSBFDSGP-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 116.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.90 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|